magarprashuram magarprashuram

25-11-2020
English

contestada

his father will write a letter.(passive negative)

Respuesta :

obaidsaeed13 obaidsaeed13

25-11-2020

Answer: A letter will not be written by his father.

Answer Link

Otras preguntas

What happens when a person has 1 copy of a recessive gene and another copy of a different recessive gene?

Which of the following generally responds well to bleaching procedures? 1) Teeth 2) Hair 3) Skin 4) Nails

Headspace is the distance between the ________of the T?slot for the cartridges on the front face of the_________ and a particular point on the front part of the

cos(x+pi/6)-cos(x-pi/6)=1How do I solve this by using the sum and difference formulas?

How are bacteria cells different from human cells?

Which parts of the story in Nakamitsu are cultural elements? Select all that apply.

Please someone should help me with this: write short notes on the following:1 . Chromosome 2. Centromere

Joseph joined the gym. He had to pay a one-time registration fee of $25, plus a monthly fee of $35. Write and solve an equation to determine how many months Jos

Feulgen reaction (technique) is used for visualization of:A. DNAB. RNA - polumeraseC. DNA - polymeraseD. Both A and C

VISION & BRAIN: What did Hubel and Wiesal's experiment of flashing spots of light in retinal receptive fields demonstrate?