clairramos8 clairramos8

22-04-2020
Biology

contestada

Why does a person have to get a flu shot every year? Why isn't one flu shot for life enough?

Respuesta :

fussellk fussellk

22-04-2020

Answer:

because every year there is a new strain of flu

Explanation:

Answer Link

myasassman18 myasassman18

22-04-2020

Answer:

Because you’ll get sick

Explanation:

Answer Link

Otras preguntas

There are 6 chemical elements represented by Li, Na, Mg, Rb, Cs, and Fr that are written on separate pieces paper. You randomly choose 3 elements, one at a time

When Sam's girlfriend broke up with him, he became extremely distressed and angry. He began to drink heavily and use illicit substances in order to cope with hi

ASAP!! Please help me. I will not accept nonsense answers, but will mark as BRAINLIEST if you answer is correctly with solutions.

If throughout an accounting period the fees for legal services paid in advance by clients are recorded in an account called Unearned Legal Fees, the end-of-peri

Give the IUPAC name of the given compound.(CH3)-CH(NH2)-CH3

Sarah has a bag of green and yellow marbles. The number of yellow marbles is 2 less than double the number of green marbles. If you let g be the variable for th

WILL MARK BRAINLIEST can someone please help me find the answer x

What distance does a mobile travel that with a constant acceleration of 3m / s increases its speed from 6m / s to 12m / s

The genomic DNA of an organism has a base composition of 40% C-G base pairs and 60% A-T base pairs. Assuming a random sequence of bases, what is the expected fr

__________ plus __________ plus __________ equals ___________. Question 13 options: a) Total deposits, loans, required reserves, excess reserves. b) Lo